C13H16Br2FNO — CID 106169569
4-bromo-N-(1-bromo-3-methylpentan-3-yl)-2-fluorobenzamide (PubChem CID 106169569) has the molecular formula C13H16Br2FNO and a molecular weight of 381.08 g/mol. Its IUPAC name is 4-bromo-N-(1-bromo-3-methylpentan-3-yl)-2-fluorobenzamide.
| Compound Name | 4-bromo-N-(1-bromo-3-methylpentan-3-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 106169569 |
| Molecular Formula | C13H16Br2FNO |
| Molecular Weight | 381.08 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 4-bromo-N-(1-bromo-3-methylpentan-3-yl)-2-fluorobenzamide |
| SMILES | CCC(C)(CCBr)NC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H16Br2FNO/c1-3-13(2,6-7-14)17-12(18)10-5-4-9(15)8-11(10)16/h4-5,8H,3,6-7H2,1-2H3,(H,17,18) |
| InChIKey | RMJBDPCANJPEMN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.08 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|