C16H21BrFNO3 — CID 176849358
(4-bromo-2-fluorophenyl)-[1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidin-3-yl]methanone (PubChem CID 176849358) has the molecular formula C16H21BrFNO3 and a molecular weight of 374.25 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)-[1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidin-3-yl]methanone.
| Compound Name | (4-bromo-2-fluorophenyl)-[1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 176849358 |
| Molecular Formula | C16H21BrFNO3 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (4-bromo-2-fluorophenyl)-[1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidin-3-yl]methanone |
| SMILES | CC(C)(C)OC(O)N1CCC(C(=O)c2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C16H21BrFNO3/c1-16(2,3)22-15(21)19-7-6-10(9-19)14(20)12-5-4-11(17)8-13(12)18/h4-5,8,10,15,21H,6-7,9H2,1-3H3 |
| InChIKey | MFQLPCBTGNTTGF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|