C16H21ClO2 — CID 114975303
(4-chloro-2-methoxyphenyl)-(3,5-dimethylcyclohexyl)methanone (PubChem CID 114975303) has the molecular formula C16H21ClO2 and a molecular weight of 280.80 g/mol. Its IUPAC name is (4-chloro-2-methoxyphenyl)-(3,5-dimethylcyclohexyl)methanone.
| Compound Name | (4-chloro-2-methoxyphenyl)-(3,5-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 114975303 |
| Molecular Formula | C16H21ClO2 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (4-chloro-2-methoxyphenyl)-(3,5-dimethylcyclohexyl)methanone |
| SMILES | COc1cc(Cl)ccc1C(=O)C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C16H21ClO2/c1-10-6-11(2)8-12(7-10)16(18)14-5-4-13(17)9-15(14)19-3/h4-5,9-12H,6-8H2,1-3H3 |
| InChIKey | VQDHMEMERDMQSQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |