C12H15BrN2O — CID 43630056
N-(3-aminocyclobutyl)-4-bromo-2-methylbenzamide (PubChem CID 43630056) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-4-bromo-2-methylbenzamide.
| Compound Name | N-(3-aminocyclobutyl)-4-bromo-2-methylbenzamide |
|---|---|
| PubChem CID | 43630056 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | N-(3-aminocyclobutyl)-4-bromo-2-methylbenzamide |
| SMILES | Cc1cc(Br)ccc1C(=O)NC1CC(N)C1 |
| InChI | InChI=1S/C12H15BrN2O/c1-7-4-8(13)2-3-11(7)12(16)15-10-5-9(14)6-10/h2-4,9-10H,5-6,14H2,1H3,(H,15,16) |
| InChIKey | UOQBCLVSGWMXDP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |