C15H20BrN3OS — CID 63627498
N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-4-bromo-2-methylbenzamide (PubChem CID 63627498) has the molecular formula C15H20BrN3OS and a molecular weight of 370.32 g/mol. Its IUPAC name is N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-4-bromo-2-methylbenzamide.
| Compound Name | N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-4-bromo-2-methylbenzamide |
|---|---|
| PubChem CID | 63627498 |
| Molecular Formula | C15H20BrN3OS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-4-bromo-2-methylbenzamide |
| SMILES | Cc1cc(Br)ccc1C(=O)NC1CCN(CC(N)=S)CC1 |
| InChI | InChI=1S/C15H20BrN3OS/c1-10-8-11(16)2-3-13(10)15(20)18-12-4-6-19(7-5-12)9-14(17)21/h2-3,8,12H,4-7,9H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | MQNNTBYHMFEBBS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|