C22H20Cl2F3N5O6 — CID 175716312
butyl N-[2-[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-3,5-dioxo-1,2,4-triazin-6-yl]carbamate (PubChem CID 175716312) has the molecular formula C22H20Cl2F3N5O6 and a molecular weight of 578.33 g/mol. Its IUPAC name is butyl N-[2-[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-3,5-dioxo-1,2,4-triazin-6-yl]carbamate.
| Compound Name | butyl N-[2-[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-3,5-dioxo-1,2,4-triazin-6-yl]carbamate |
|---|---|
| PubChem CID | 175716312 |
| Molecular Formula | C22H20Cl2F3N5O6 |
| Molecular Weight | 578.33 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | butyl N-[2-[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-3,5-dioxo-1,2,4-triazin-6-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1nn(-c2cc(Cl)c(Oc3ccc(=O)n(C(C)C(F)(F)F)c3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H20Cl2F3N5O6/c1-3-4-7-37-21(36)28-18-19(34)29-20(35)32(30-18)12-8-14(23)17(15(24)9-12)38-13-5-6-16(33)31(10-13)11(2)22(25,26)27/h5-6,8-11H,3-4,7H2,1-2H3,(H,28,30,36)(H,29,34,35) |
| InChIKey | SYJJMFRTJJRIMJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|