C24H15Cl2FN6O4 — CID 167477314
6-[2,6-dichloro-4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-8-fluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indole-5-carbonitrile (PubChem CID 167477314) has the molecular formula C24H15Cl2FN6O4 and a molecular weight of 541.33 g/mol. Its IUPAC name is 6-[2,6-dichloro-4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-8-fluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indole-5-carbonitrile.
| Compound Name | 6-[2,6-dichloro-4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-8-fluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indole-5-carbonitrile |
|---|---|
| PubChem CID | 167477314 |
| Molecular Formula | C24H15Cl2FN6O4 |
| Molecular Weight | 541.33 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | 6-[2,6-dichloro-4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-8-fluoro-4,4-dimethyl-3,9-dihydro-1H-pyrano[3,4-b]indole-5-carbonitrile |
| SMILES | CC1(C)COCc2[nH]c3c(F)cc(Oc4c(Cl)cc(-n5nc(C#N)c(=O)[nH]c5=O)cc4Cl)c(C#N)c3c21 |
| InChI | InChI=1S/C24H15Cl2FN6O4/c1-24(2)9-36-8-16-19(24)18-11(6-28)17(5-14(27)20(18)30-16)37-21-12(25)3-10(4-13(21)26)33-23(35)31-22(34)15(7-29)32-33/h3-5,30H,8-9H2,1-2H3,(H,31,34,35) |
| InChIKey | CPWIGIXIYTWQQL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |