C26H22ClF3N6O3 — CID 167477326
2-[3-chloro-5-methyl-4-[[1,4,4-trimethyl-1-(trifluoromethyl)-3,9-dihydro-2H-pyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 167477326) has the molecular formula C26H22ClF3N6O3 and a molecular weight of 558.95 g/mol. Its IUPAC name is 2-[3-chloro-5-methyl-4-[[1,4,4-trimethyl-1-(trifluoromethyl)-3,9-dihydro-2H-pyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3-chloro-5-methyl-4-[[1,4,4-trimethyl-1-(trifluoromethyl)-3,9-dihydro-2H-pyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 167477326 |
| Molecular Formula | C26H22ClF3N6O3 |
| Molecular Weight | 558.95 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 2-[3-chloro-5-methyl-4-[[1,4,4-trimethyl-1-(trifluoromethyl)-3,9-dihydro-2H-pyrido[3,4-b]indol-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | Cc1cc(-n2nc(C#N)c(=O)[nH]c2=O)cc(Cl)c1Oc1ccc2[nH]c3c(c2c1)C(C)(C)CNC3(C)C(F)(F)F |
| InChI | InChI=1S/C26H22ClF3N6O3/c1-12-7-13(36-23(38)34-22(37)18(10-31)35-36)8-16(27)20(12)39-14-5-6-17-15(9-14)19-21(33-17)25(4,26(28,29)30)32-11-24(19,2)3/h5-9,32-33H,11H2,1-4H3,(H,34,37,38) |
| InChIKey | AHYOXEZNWKITJO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.95 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |