C21H12Cl2FN5O4 — CID 163293756
2-[3,5-dichloro-4-(4-fluoro-2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 163293756) has the molecular formula C21H12Cl2FN5O4 and a molecular weight of 488.26 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(4-fluoro-2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-(4-fluoro-2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 163293756 |
| Molecular Formula | C21H12Cl2FN5O4 |
| Molecular Weight | 488.26 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | 2-[3,5-dichloro-4-(4-fluoro-2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2cc(Cl)c(Oc3ccc4c(c3F)C3(CCC3)C(=O)N4)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H12Cl2FN5O4/c22-10-6-9(29-20(32)27-18(30)13(8-25)28-29)7-11(23)17(10)33-14-3-2-12-15(16(14)24)21(4-1-5-21)19(31)26-12/h2-3,6-7H,1,4-5H2,(H,26,31)(H,27,30,32) |
| InChIKey | RDIIITALBPJZQQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |