C19H14Cl2N6O5 — CID 155363981
2-[3,5-dichloro-4-[(5-methoxy-4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 155363981) has the molecular formula C19H14Cl2N6O5 and a molecular weight of 477.26 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(5-methoxy-4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[(5-methoxy-4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 155363981 |
| Molecular Formula | C19H14Cl2N6O5 |
| Molecular Weight | 477.26 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 2-[3,5-dichloro-4-[(5-methoxy-4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | COC1CCCc2c(Oc3c(Cl)cc(-n4nc(C#N)c(=O)[nH]c4=O)cc3Cl)n[nH]c(=O)c21 |
| InChI | InChI=1S/C19H14Cl2N6O5/c1-31-13-4-2-3-9-14(13)17(29)24-25-18(9)32-15-10(20)5-8(6-11(15)21)27-19(30)23-16(28)12(7-22)26-27/h5-6,13H,2-4H2,1H3,(H,24,29)(H,23,28,30) |
| InChIKey | STSHAUGZFYOWAI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 155.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |