C20H18Cl2N6O4 — CID 163293567
6-amino-2-[3,5-dichloro-4-(1-oxospiro[5,6-dihydro-2H-cyclopenta[d]pyridazine-7,1'-cyclopentane]-4-yl)oxyphenyl]-1,2,4-triazine-3,5-dione (PubChem CID 163293567) has the molecular formula C20H18Cl2N6O4 and a molecular weight of 477.31 g/mol. Its IUPAC name is 6-amino-2-[3,5-dichloro-4-(1-oxospiro[5,6-dihydro-2H-cyclopenta[d]pyridazine-7,1'-cyclopentane]-4-yl)oxyphenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-amino-2-[3,5-dichloro-4-(1-oxospiro[5,6-dihydro-2H-cyclopenta[d]pyridazine-7,1'-cyclopentane]-4-yl)oxyphenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 163293567 |
| Molecular Formula | C20H18Cl2N6O4 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 6-amino-2-[3,5-dichloro-4-(1-oxospiro[5,6-dihydro-2H-cyclopenta[d]pyridazine-7,1'-cyclopentane]-4-yl)oxyphenyl]-1,2,4-triazine-3,5-dione |
| SMILES | Nc1nn(-c2cc(Cl)c(Oc3n[nH]c(=O)c4c3CCC43CCCC3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H18Cl2N6O4/c21-11-7-9(28-19(31)24-17(30)15(23)27-28)8-12(22)14(11)32-18-10-3-6-20(4-1-2-5-20)13(10)16(29)25-26-18/h7-8H,1-6H2,(H2,23,27)(H,25,29)(H,24,30,31) |
| InChIKey | YKGSLSOFLWIAMK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |