C18H15Cl2N5O4 — CID 164765797
6-amino-2-[3,5-dichloro-4-[(7-methyl-1-oxo-2,5,6,7-tetrahydrocyclopenta[c]pyridin-4-yl)oxy]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 164765797) has the molecular formula C18H15Cl2N5O4 and a molecular weight of 436.26 g/mol. Its IUPAC name is 6-amino-2-[3,5-dichloro-4-[(7-methyl-1-oxo-2,5,6,7-tetrahydrocyclopenta[c]pyridin-4-yl)oxy]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-amino-2-[3,5-dichloro-4-[(7-methyl-1-oxo-2,5,6,7-tetrahydrocyclopenta[c]pyridin-4-yl)oxy]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 164765797 |
| Molecular Formula | C18H15Cl2N5O4 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 6-amino-2-[3,5-dichloro-4-[(7-methyl-1-oxo-2,5,6,7-tetrahydrocyclopenta[c]pyridin-4-yl)oxy]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | CC1CCc2c(Oc3c(Cl)cc(-n4nc(N)c(=O)[nH]c4=O)cc3Cl)c[nH]c(=O)c21 |
| InChI | InChI=1S/C18H15Cl2N5O4/c1-7-2-3-9-12(6-22-16(26)13(7)9)29-14-10(19)4-8(5-11(14)20)25-18(28)23-17(27)15(21)24-25/h4-7H,2-3H2,1H3,(H2,21,24)(H,22,26)(H,23,27,28) |
| InChIKey | QVQAXHTWXRJATJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |