C23H20Cl2N6O4 — CID 166843508
6-amino-2-[3,5-dichloro-4-[[6-hydroxy-5-(3-phenylcyclobutyl)-1,6-dihydropyridazin-3-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 166843508) has the molecular formula C23H20Cl2N6O4 and a molecular weight of 515.36 g/mol. Its IUPAC name is 6-amino-2-[3,5-dichloro-4-[[6-hydroxy-5-(3-phenylcyclobutyl)-1,6-dihydropyridazin-3-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-amino-2-[3,5-dichloro-4-[[6-hydroxy-5-(3-phenylcyclobutyl)-1,6-dihydropyridazin-3-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 166843508 |
| Molecular Formula | C23H20Cl2N6O4 |
| Molecular Weight | 515.36 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 6-amino-2-[3,5-dichloro-4-[[6-hydroxy-5-(3-phenylcyclobutyl)-1,6-dihydropyridazin-3-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | Nc1nn(-c2cc(Cl)c(OC3=NNC(O)C(C4CC(c5ccccc5)C4)=C3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H20Cl2N6O4/c24-16-8-14(31-23(34)27-22(33)20(26)30-31)9-17(25)19(16)35-18-10-15(21(32)29-28-18)13-6-12(7-13)11-4-2-1-3-5-11/h1-5,8-10,12-13,21,29,32H,6-7H2,(H2,26,30)(H,27,33,34) |
| InChIKey | LPKWMDZFGCJKOK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |