C19H19Cl2N5O4S — CID 155276816
2-[3,5-dichloro-4-[(6-propan-2-yl-8-oxa-2,3-diazabicyclo[5.1.0]octa-3,5-dien-4-yl)oxy]phenyl]-6-(methylsulfanylmethyl)-1,2,4-triazine-3,5-dione (PubChem CID 155276816) has the molecular formula C19H19Cl2N5O4S and a molecular weight of 484.37 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(6-propan-2-yl-8-oxa-2,3-diazabicyclo[5.1.0]octa-3,5-dien-4-yl)oxy]phenyl]-6-(methylsulfanylmethyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[(6-propan-2-yl-8-oxa-2,3-diazabicyclo[5.1.0]octa-3,5-dien-4-yl)oxy]phenyl]-6-(methylsulfanylmethyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 155276816 |
| Molecular Formula | C19H19Cl2N5O4S |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 2-[3,5-dichloro-4-[(6-propan-2-yl-8-oxa-2,3-diazabicyclo[5.1.0]octa-3,5-dien-4-yl)oxy]phenyl]-6-(methylsulfanylmethyl)-1,2,4-triazine-3,5-dione |
| SMILES | CSCc1nn(-c2cc(Cl)c(OC3=NNC4OC4C(C(C)C)=C3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H19Cl2N5O4S/c1-8(2)10-6-14(23-24-18-15(10)30-18)29-16-11(20)4-9(5-12(16)21)26-19(28)22-17(27)13(25-26)7-31-3/h4-6,8,15,18,24H,7H2,1-3H3,(H,22,27,28) |
| InChIKey | DPHXMZXUHRLRMB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 113.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|