C24H18Cl3N5O5 — CID 166060533
ethyl N-[2-[[4-[(1-benzyl-5-chloro-6-oxo-3-pyridinyl)oxy]-3,5-dichlorophenyl]hydrazinylidene]-2-cyanoacetyl]carbamate (PubChem CID 166060533) has the molecular formula C24H18Cl3N5O5 and a molecular weight of 562.80 g/mol. Its IUPAC name is ethyl N-[2-[[4-[(1-benzyl-5-chloro-6-oxo-3-pyridinyl)oxy]-3,5-dichlorophenyl]hydrazinylidene]-2-cyanoacetyl]carbamate.
| Compound Name | ethyl N-[2-[[4-[(1-benzyl-5-chloro-6-oxo-3-pyridinyl)oxy]-3,5-dichlorophenyl]hydrazinylidene]-2-cyanoacetyl]carbamate |
|---|---|
| PubChem CID | 166060533 |
| Molecular Formula | C24H18Cl3N5O5 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | ethyl N-[2-[[4-[(1-benzyl-5-chloro-6-oxo-3-pyridinyl)oxy]-3,5-dichlorophenyl]hydrazinylidene]-2-cyanoacetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2cc(Cl)c(=O)n(Cc3ccccc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C24H18Cl3N5O5/c1-2-36-24(35)29-22(33)20(11-28)31-30-15-8-17(25)21(18(26)9-15)37-16-10-19(27)23(34)32(13-16)12-14-6-4-3-5-7-14/h3-10,13,30H,2,12H2,1H3,(H,29,33,35) |
| InChIKey | OVNFGPNVBWETCQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|