C22H15Cl2FN6O5 — CID 164850608
ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 164850608) has the molecular formula C22H15Cl2FN6O5 and a molecular weight of 533.30 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 164850608 |
| Molecular Formula | C22H15Cl2FN6O5 |
| Molecular Weight | 533.30 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2ccc(=O)n(-c3ccc(F)cc3)n2)c(Cl)c1 |
| InChI | InChI=1S/C22H15Cl2FN6O5/c1-2-35-22(34)27-21(33)17(11-26)29-28-13-9-15(23)20(16(24)10-13)36-18-7-8-19(32)31(30-18)14-5-3-12(25)4-6-14/h3-10,28H,2H2,1H3,(H,27,33,34) |
| InChIKey | SXJHFRHETXUCCI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 147.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|