C21H18Cl2N6O4 — CID 156644722
ethyl N-[(2E)-2-cyano-2-[[3,5-dichloro-4-[(3-ethyl-2H-indazol-5-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 156644722) has the molecular formula C21H18Cl2N6O4 and a molecular weight of 489.32 g/mol. Its IUPAC name is ethyl N-[(2E)-2-cyano-2-[[3,5-dichloro-4-[(3-ethyl-2H-indazol-5-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[(2E)-2-cyano-2-[[3,5-dichloro-4-[(3-ethyl-2H-indazol-5-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 156644722 |
| Molecular Formula | C21H18Cl2N6O4 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | ethyl N-[(2E)-2-cyano-2-[[3,5-dichloro-4-[(3-ethyl-2H-indazol-5-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=N/Nc1cc(Cl)c(Oc2ccc3n[nH]c(CC)c3c2)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl2N6O4/c1-3-16-13-9-12(5-6-17(13)28-27-16)33-19-14(22)7-11(8-15(19)23)26-29-18(10-24)20(30)25-21(31)32-4-2/h5-9,26H,3-4H2,1-2H3,(H,27,28)(H,25,30,31)/b29-18+ |
| InChIKey | STQOWXACBDQMKS-RDRPBHBLSA-N |
| XLogP | 4.79 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|