C22H26Cl2N2O3Si — CID 155637455
6-(4-amino-2,6-dichlorophenoxy)-3-methyl-1-(2-trimethylsilylethoxymethyl)quinolin-2-one (PubChem CID 155637455) has the molecular formula C22H26Cl2N2O3Si and a molecular weight of 465.45 g/mol. Its IUPAC name is 6-(4-amino-2,6-dichlorophenoxy)-3-methyl-1-(2-trimethylsilylethoxymethyl)quinolin-2-one.
| Compound Name | 6-(4-amino-2,6-dichlorophenoxy)-3-methyl-1-(2-trimethylsilylethoxymethyl)quinolin-2-one |
|---|---|
| PubChem CID | 155637455 |
| Molecular Formula | C22H26Cl2N2O3Si |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 6-(4-amino-2,6-dichlorophenoxy)-3-methyl-1-(2-trimethylsilylethoxymethyl)quinolin-2-one |
| SMILES | Cc1cc2cc(Oc3c(Cl)cc(N)cc3Cl)ccc2n(COCC[Si](C)(C)C)c1=O |
| InChI | InChI=1S/C22H26Cl2N2O3Si/c1-14-9-15-10-17(29-21-18(23)11-16(25)12-19(21)24)5-6-20(15)26(22(14)27)13-28-7-8-30(2,3)4/h5-6,9-12H,7-8,13,25H2,1-4H3 |
| InChIKey | JHBISRHONYFKFV-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|