C16H24N2O2Si — CID 70196598
2,5-dimethyl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one (PubChem CID 70196598) has the molecular formula C16H24N2O2Si and a molecular weight of 304.47 g/mol. Its IUPAC name is 2,5-dimethyl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one.
| Compound Name | 2,5-dimethyl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 70196598 |
| Molecular Formula | C16H24N2O2Si |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2,5-dimethyl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
| SMILES | Cc1cccc2nc(C)n(COCC[Si](C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C16H24N2O2Si/c1-12-7-6-8-14-15(12)16(19)18(13(2)17-14)11-20-9-10-21(3,4)5/h6-8H,9-11H2,1-5H3 |
| InChIKey | LXYNJJWOBVRSPL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|