C18H30N2OSi2 — CID 14924368
trimethyl-[2-phenyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]silane (PubChem CID 14924368) has the molecular formula C18H30N2OSi2 and a molecular weight of 346.62 g/mol. Its IUPAC name is trimethyl-[2-phenyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]silane.
| Compound Name | trimethyl-[2-phenyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]silane |
|---|---|
| PubChem CID | 14924368 |
| Molecular Formula | C18H30N2OSi2 |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | trimethyl-[2-phenyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]silane |
| SMILES | C[Si](C)(C)CCOCn1c([Si](C)(C)C)cnc1-c1ccccc1 |
| InChI | InChI=1S/C18H30N2OSi2/c1-22(2,3)13-12-21-15-20-17(23(4,5)6)14-19-18(20)16-10-8-7-9-11-16/h7-11,14H,12-13,15H2,1-6H3 |
| InChIKey | LHCKXAIPDBTYLP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|