C23H24F6N2OSi — CID 46895437
2-[[2,5-bis[4-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 46895437) has the molecular formula C23H24F6N2OSi and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-[[2,5-bis[4-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2,5-bis[4-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 46895437 |
| Molecular Formula | C23H24F6N2OSi |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-[[2,5-bis[4-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(C(F)(F)F)cc2)cnc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H24F6N2OSi/c1-33(2,3)13-12-32-15-31-20(16-4-8-18(9-5-16)22(24,25)26)14-30-21(31)17-6-10-19(11-7-17)23(27,28)29/h4-11,14H,12-13,15H2,1-3H3 |
| InChIKey | HAKSWVIHCDTNBN-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|