C19H22F3N3O2PSi+ — CID 175903508
trimethyl-[2-[[6-phosphoroso-4-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-d]pyrimidin-1-ium-7-yl]methoxy]ethyl]silane (PubChem CID 175903508) has the molecular formula C19H22F3N3O2PSi+ and a molecular weight of 440.46 g/mol. Its IUPAC name is trimethyl-[2-[[6-phosphoroso-4-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-d]pyrimidin-1-ium-7-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[6-phosphoroso-4-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-d]pyrimidin-1-ium-7-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 175903508 |
| Molecular Formula | C19H22F3N3O2PSi+ |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | trimethyl-[2-[[6-phosphoroso-4-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-d]pyrimidin-1-ium-7-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1c(P=O)cc2c(-c3cccc(C(F)(F)F)c3)nc[nH+]c21 |
| InChI | InChI=1S/C19H21F3N3O2PSi/c1-29(2,3)8-7-27-12-25-16(28-26)10-15-17(23-11-24-18(15)25)13-5-4-6-14(9-13)19(20,21)22/h4-6,9-11H,7-8,12H2,1-3H3/p+1 |
| InChIKey | KXPQLSGAWSPVTK-UHFFFAOYSA-O |
| XLogP | 4.77 |
| TPSA | 58.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|