C25H32F3N3O3SSi — CID 22969494
N-methyl-N-[3-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]ethanesulfonamide (PubChem CID 22969494) has the molecular formula C25H32F3N3O3SSi and a molecular weight of 539.70 g/mol. Its IUPAC name is N-methyl-N-[3-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]ethanesulfonamide.
| Compound Name | N-methyl-N-[3-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 22969494 |
| Molecular Formula | C25H32F3N3O3SSi |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N-methyl-N-[3-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C)c1cccc(-c2nc(-c3cccc(C(F)(F)F)c3)cn2COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C25H32F3N3O3SSi/c1-6-35(32,33)30(2)22-12-8-10-20(16-22)24-29-23(17-31(24)18-34-13-14-36(3,4)5)19-9-7-11-21(15-19)25(26,27)28/h7-12,15-17H,6,13-14,18H2,1-5H3 |
| InChIKey | IAJRPBYFXVXGEF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|