C36H38F4N4O3Si — CID 91350536
8-[4-[3-(4-fluorocyclohexa-2,4-dien-1-yl)prop-2-ynoxy]phenyl]-1-propyl-2-[3-(trifluoromethyl)phenyl]-7-(2-trimethylsilylethoxymethyl)purin-6-one (PubChem CID 91350536) has the molecular formula C36H38F4N4O3Si and a molecular weight of 678.80 g/mol. Its IUPAC name is 8-[4-[3-(4-fluorocyclohexa-2,4-dien-1-yl)prop-2-ynoxy]phenyl]-1-propyl-2-[3-(trifluoromethyl)phenyl]-7-(2-trimethylsilylethoxymethyl)purin-6-one.
| Compound Name | 8-[4-[3-(4-fluorocyclohexa-2,4-dien-1-yl)prop-2-ynoxy]phenyl]-1-propyl-2-[3-(trifluoromethyl)phenyl]-7-(2-trimethylsilylethoxymethyl)purin-6-one |
|---|---|
| PubChem CID | 91350536 |
| Molecular Formula | C36H38F4N4O3Si |
| Molecular Weight | 678.80 g/mol |
| Exact Mass | 678.26 |
| IUPAC Name | 8-[4-[3-(4-fluorocyclohexa-2,4-dien-1-yl)prop-2-ynoxy]phenyl]-1-propyl-2-[3-(trifluoromethyl)phenyl]-7-(2-trimethylsilylethoxymethyl)purin-6-one |
| SMILES | CCCn1c(-c2cccc(C(F)(F)F)c2)nc2nc(-c3ccc(OCC#CC4C=CC(F)=CC4)cc3)n(COCC[Si](C)(C)C)c2c1=O |
| InChI | InChI=1S/C36H38F4N4O3Si/c1-5-19-43-34(27-9-6-10-28(23-27)36(38,39)40)42-32-31(35(43)45)44(24-46-21-22-48(2,3)4)33(41-32)26-13-17-30(18-14-26)47-20-7-8-25-11-15-29(37)16-12-25/h6,9-11,13-18,23,25H,5,12,19-22,24H2,1-4H3 |
| InChIKey | YCFPCZAUFPBICL-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.80 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|