C18H24Br2F2N2OSi — CID 142022669
2-[[4,5-dibromo-2-[3-(1,1-difluoropropyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 142022669) has the molecular formula C18H24Br2F2N2OSi and a molecular weight of 510.29 g/mol. Its IUPAC name is 2-[[4,5-dibromo-2-[3-(1,1-difluoropropyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4,5-dibromo-2-[3-(1,1-difluoropropyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 142022669 |
| Molecular Formula | C18H24Br2F2N2OSi |
| Molecular Weight | 510.29 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | 2-[[4,5-dibromo-2-[3-(1,1-difluoropropyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC(F)(F)c1cccc(-c2nc(Br)c(Br)n2COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C18H24Br2F2N2OSi/c1-5-18(21,22)14-8-6-7-13(11-14)17-23-15(19)16(20)24(17)12-25-9-10-26(2,3)4/h6-8,11H,5,9-10,12H2,1-4H3 |
| InChIKey | NZZWHNUIPOGIIW-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.29 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|