C27H35F3N4OSi — CID 59073926
trimethyl-[2-[[2-[4-(4-methylphenyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 59073926) has the molecular formula C27H35F3N4OSi and a molecular weight of 516.68 g/mol. Its IUPAC name is trimethyl-[2-[[2-[4-(4-methylphenyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[2-[4-(4-methylphenyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 59073926 |
| Molecular Formula | C27H35F3N4OSi |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | trimethyl-[2-[[2-[4-(4-methylphenyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1ccc(N2CCN(c3nc(-c4cccc(C(F)(F)F)c4)cn3COCC[Si](C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H35F3N4OSi/c1-21-8-10-24(11-9-21)32-12-14-33(15-13-32)26-31-25(19-34(26)20-35-16-17-36(2,3)4)22-6-5-7-23(18-22)27(28,29)30/h5-11,18-19H,12-17,20H2,1-4H3 |
| InChIKey | UBTNTGDPVNWPEF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|