C27H40F3N3O3Si — CID 90972913
tert-butyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;trimethyl-[2-[[4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 90972913) has the molecular formula C27H40F3N3O3Si and a molecular weight of 539.72 g/mol. Its IUPAC name is tert-butyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;trimethyl-[2-[[4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | tert-butyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;trimethyl-[2-[[4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 90972913 |
| Molecular Formula | C27H40F3N3O3Si |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | tert-butyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;trimethyl-[2-[[4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | CC1=CCN(C(=O)OC(C)(C)C)CC1.C[Si](C)(C)CCOCn1cnc(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H21F3N2OSi.C11H19NO2/c1-23(2,3)8-7-22-12-21-10-15(20-11-21)13-5-4-6-14(9-13)16(17,18)19;1-9-5-7-12(8-6-9)10(13)14-11(2,3)4/h4-6,9-11H,7-8,12H2,1-3H3;5H,6-8H2,1-4H3 |
| InChIKey | PLJNAZDCFNZMHI-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|