C22H24BrF3N2OSi — CID 22969432
2-[[2-(3-bromophenyl)-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 22969432) has the molecular formula C22H24BrF3N2OSi and a molecular weight of 497.43 g/mol. Its IUPAC name is 2-[[2-(3-bromophenyl)-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(3-bromophenyl)-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 22969432 |
| Molecular Formula | C22H24BrF3N2OSi |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 2-[[2-(3-bromophenyl)-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cccc(C(F)(F)F)c2)nc1-c1cccc(Br)c1 |
| InChI | InChI=1S/C22H24BrF3N2OSi/c1-30(2,3)11-10-29-15-28-14-20(16-6-4-8-18(12-16)22(24,25)26)27-21(28)17-7-5-9-19(23)13-17/h4-9,12-14H,10-11,15H2,1-3H3 |
| InChIKey | ZTBXOUMTVRVMOR-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|