C18H25ClN2O3Si — CID 156643880
ethyl 4-(3-chlorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylate (PubChem CID 156643880) has the molecular formula C18H25ClN2O3Si and a molecular weight of 380.95 g/mol. Its IUPAC name is ethyl 4-(3-chlorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylate.
| Compound Name | ethyl 4-(3-chlorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylate |
|---|---|
| PubChem CID | 156643880 |
| Molecular Formula | C18H25ClN2O3Si |
| Molecular Weight | 380.95 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl 4-(3-chlorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cccc(Cl)c2)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H25ClN2O3Si/c1-5-24-18(22)17-20-16(14-7-6-8-15(19)11-14)12-21(17)13-23-9-10-25(2,3)4/h6-8,11-12H,5,9-10,13H2,1-4H3 |
| InChIKey | VVAJBFBZLZYMCJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.95 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|