C19H24ClN3O3SSi — CID 142530134
ethyl 3-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,2-thiazole-5-carboxylate (PubChem CID 142530134) has the molecular formula C19H24ClN3O3SSi and a molecular weight of 438.03 g/mol. Its IUPAC name is ethyl 3-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,2-thiazole-5-carboxylate.
| Compound Name | ethyl 3-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,2-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 142530134 |
| Molecular Formula | C19H24ClN3O3SSi |
| Molecular Weight | 438.03 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | ethyl 3-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,2-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cn(COCC[Si](C)(C)C)c3nccc(Cl)c23)ns1 |
| InChI | InChI=1S/C19H24ClN3O3SSi/c1-5-26-19(24)16-10-15(22-27-16)13-11-23(12-25-8-9-28(2,3)4)18-17(13)14(20)6-7-21-18/h6-7,10-11H,5,8-9,12H2,1-4H3 |
| InChIKey | DMQDXPPUWVBBKX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.03 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|