C19H22ClF2N3O2Si — CID 168833190
4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2,5-difluoroaniline (PubChem CID 168833190) has the molecular formula C19H22ClF2N3O2Si and a molecular weight of 425.94 g/mol. Its IUPAC name is 4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2,5-difluoroaniline.
| Compound Name | 4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2,5-difluoroaniline |
|---|---|
| PubChem CID | 168833190 |
| Molecular Formula | C19H22ClF2N3O2Si |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2,5-difluoroaniline |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(Oc3cc(F)c(N)cc3F)ccnc21 |
| InChI | InChI=1S/C19H22ClF2N3O2Si/c1-28(2,3)7-6-26-11-25-10-12(20)18-16(4-5-24-19(18)25)27-17-9-13(21)15(23)8-14(17)22/h4-5,8-10H,6-7,11,23H2,1-3H3 |
| InChIKey | UUDVZPGPTNXDMC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|