C24H29ClF2N4O4Si — CID 157126658
1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(3R)-oxolan-3-yl]urea (PubChem CID 157126658) has the molecular formula C24H29ClF2N4O4Si and a molecular weight of 539.06 g/mol. Its IUPAC name is 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(3R)-oxolan-3-yl]urea.
| Compound Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(3R)-oxolan-3-yl]urea |
|---|---|
| PubChem CID | 157126658 |
| Molecular Formula | C24H29ClF2N4O4Si |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(3R)-oxolan-3-yl]urea |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(Oc3c(F)cc(NC(=O)N[C@@H]4CCOC4)cc3F)ccnc21 |
| InChI | InChI=1S/C24H29ClF2N4O4Si/c1-36(2,3)9-8-34-14-31-12-17(25)21-20(4-6-28-23(21)31)35-22-18(26)10-16(11-19(22)27)30-24(32)29-15-5-7-33-13-15/h4,6,10-12,15H,5,7-9,13-14H2,1-3H3,(H2,29,30,32)/t15-/m1/s1 |
| InChIKey | AIOUTJDFFMEEFK-OAHLLOKOSA-N |
| XLogP | 5.98 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|