C24H24F5N5O3SSi — CID 142494706
1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(1,2-thiazol-4-yl)urea (PubChem CID 142494706) has the molecular formula C24H24F5N5O3SSi and a molecular weight of 585.63 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(1,2-thiazol-4-yl)urea.
| Compound Name | 1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(1,2-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 142494706 |
| Molecular Formula | C24H24F5N5O3SSi |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | 1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(1,2-thiazol-4-yl)urea |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)(F)F)c2c(Oc3c(F)cc(NC(=O)Nc4cnsc4)cc3F)ccnc21 |
| InChI | InChI=1S/C24H24F5N5O3SSi/c1-39(2,3)7-6-36-13-34-11-16(24(27,28)29)20-19(4-5-30-22(20)34)37-21-17(25)8-14(9-18(21)26)32-23(35)33-15-10-31-38-12-15/h4-5,8-12H,6-7,13H2,1-3H3,(H2,32,33,35) |
| InChIKey | WQSBNMLQKXPOSG-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|