C20H20F5IN2O2Si — CID 146992251
2-[[4-(2,6-difluoro-4-iodophenoxy)-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 146992251) has the molecular formula C20H20F5IN2O2Si and a molecular weight of 570.37 g/mol. Its IUPAC name is 2-[[4-(2,6-difluoro-4-iodophenoxy)-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(2,6-difluoro-4-iodophenoxy)-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 146992251 |
| Molecular Formula | C20H20F5IN2O2Si |
| Molecular Weight | 570.37 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | 2-[[4-(2,6-difluoro-4-iodophenoxy)-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)(F)F)c2c(Oc3c(F)cc(I)cc3F)ccnc21 |
| InChI | InChI=1S/C20H20F5IN2O2Si/c1-31(2,3)7-6-29-11-28-10-13(20(23,24)25)17-16(4-5-27-19(17)28)30-18-14(21)8-12(26)9-15(18)22/h4-5,8-10H,6-7,11H2,1-3H3 |
| InChIKey | AQKLNDGCMDVWGC-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.37 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|