C27H29F2N3O4Si — CID 142494673
phenyl N-[3,5-difluoro-4-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]carbamate (PubChem CID 142494673) has the molecular formula C27H29F2N3O4Si and a molecular weight of 525.63 g/mol. Its IUPAC name is phenyl N-[3,5-difluoro-4-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]carbamate.
| Compound Name | phenyl N-[3,5-difluoro-4-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]carbamate |
|---|---|
| PubChem CID | 142494673 |
| Molecular Formula | C27H29F2N3O4Si |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | phenyl N-[3,5-difluoro-4-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]carbamate |
| SMILES | Cc1cn(COCC[Si](C)(C)C)c2nccc(Oc3c(F)cc(NC(=O)Oc4ccccc4)cc3F)c12 |
| InChI | InChI=1S/C27H29F2N3O4Si/c1-18-16-32(17-34-12-13-37(2,3)4)26-24(18)23(10-11-30-26)36-25-21(28)14-19(15-22(25)29)31-27(33)35-20-8-6-5-7-9-20/h5-11,14-16H,12-13,17H2,1-4H3,(H,31,33) |
| InChIKey | OJFJDXLZZMCJPI-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|