C26H26BrF2N3O3SSi — CID 142494818
phenyl N-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]sulfanyl-3,5-difluorophenyl]carbamate (PubChem CID 142494818) has the molecular formula C26H26BrF2N3O3SSi and a molecular weight of 606.57 g/mol. Its IUPAC name is phenyl N-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]sulfanyl-3,5-difluorophenyl]carbamate.
| Compound Name | phenyl N-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]sulfanyl-3,5-difluorophenyl]carbamate |
|---|---|
| PubChem CID | 142494818 |
| Molecular Formula | C26H26BrF2N3O3SSi |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 605.06 |
| IUPAC Name | phenyl N-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]sulfanyl-3,5-difluorophenyl]carbamate |
| SMILES | C[Si](C)(C)CCOCn1cc(Br)c2c(Sc3c(F)cc(NC(=O)Oc4ccccc4)cc3F)ccnc21 |
| InChI | InChI=1S/C26H26BrF2N3O3SSi/c1-37(2,3)12-11-34-16-32-15-19(27)23-22(9-10-30-25(23)32)36-24-20(28)13-17(14-21(24)29)31-26(33)35-18-7-5-4-6-8-18/h4-10,13-15H,11-12,16H2,1-3H3,(H,31,33) |
| InChIKey | JCTLPGDUEYTPGH-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|