C16H23BrN2O3Si — CID 140891564
methyl 2-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]acetate (PubChem CID 140891564) has the molecular formula C16H23BrN2O3Si and a molecular weight of 399.36 g/mol. Its IUPAC name is methyl 2-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]acetate.
| Compound Name | methyl 2-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 140891564 |
| Molecular Formula | C16H23BrN2O3Si |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | methyl 2-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]acetate |
| SMILES | COC(=O)Cc1cn(COCC[Si](C)(C)C)c2nccc(Br)c12 |
| InChI | InChI=1S/C16H23BrN2O3Si/c1-21-14(20)9-12-10-19(11-22-7-8-23(2,3)4)16-15(12)13(17)5-6-18-16/h5-6,10H,7-9,11H2,1-4H3 |
| InChIKey | ZCWRGBCJFBSSBV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|