C17H25BrN2O2Si — CID 150791440
[2-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]cyclopropyl]methanol (PubChem CID 150791440) has the molecular formula C17H25BrN2O2Si and a molecular weight of 397.39 g/mol. Its IUPAC name is [2-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]cyclopropyl]methanol.
| Compound Name | [2-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 150791440 |
| Molecular Formula | C17H25BrN2O2Si |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [2-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]cyclopropyl]methanol |
| SMILES | C[Si](C)(C)CCOCn1cc(C2CC2CO)c2c(Br)ccnc21 |
| InChI | InChI=1S/C17H25BrN2O2Si/c1-23(2,3)7-6-22-11-20-9-14(13-8-12(13)10-21)16-15(18)4-5-19-17(16)20/h4-5,9,12-13,21H,6-8,10-11H2,1-3H3 |
| InChIKey | KDXYYMCDEGLJCU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|