C20H24BrFN2O2Si — CID 174084948
2-[[3-bromo-4-(3-fluoro-4-methylphenoxy)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 174084948) has the molecular formula C20H24BrFN2O2Si and a molecular weight of 451.41 g/mol. Its IUPAC name is 2-[[3-bromo-4-(3-fluoro-4-methylphenoxy)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-bromo-4-(3-fluoro-4-methylphenoxy)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174084948 |
| Molecular Formula | C20H24BrFN2O2Si |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-[[3-bromo-4-(3-fluoro-4-methylphenoxy)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1ccc(Oc2ccnc3c2c(Br)cn3COCC[Si](C)(C)C)cc1F |
| InChI | InChI=1S/C20H24BrFN2O2Si/c1-14-5-6-15(11-17(14)22)26-18-7-8-23-20-19(18)16(21)12-24(20)13-25-9-10-27(2,3)4/h5-8,11-12H,9-10,13H2,1-4H3 |
| InChIKey | IFZRVFVBYLAJEJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|