C27H33BrF2N2O4Si — CID 167536875
1-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4-(3-methyloxetan-3-yl)butan-2-one (PubChem CID 167536875) has the molecular formula C27H33BrF2N2O4Si and a molecular weight of 595.56 g/mol. Its IUPAC name is 1-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4-(3-methyloxetan-3-yl)butan-2-one.
| Compound Name | 1-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4-(3-methyloxetan-3-yl)butan-2-one |
|---|---|
| PubChem CID | 167536875 |
| Molecular Formula | C27H33BrF2N2O4Si |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 1-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4-(3-methyloxetan-3-yl)butan-2-one |
| SMILES | CC1(CCC(=O)Cc2cc(F)c(Oc3ccnc4c3c(Br)cn4COCC[Si](C)(C)C)c(F)c2)COC1 |
| InChI | InChI=1S/C27H33BrF2N2O4Si/c1-27(15-35-16-27)7-5-19(33)11-18-12-21(29)25(22(30)13-18)36-23-6-8-31-26-24(23)20(28)14-32(26)17-34-9-10-37(2,3)4/h6,8,12-14H,5,7,9-11,15-17H2,1-4H3 |
| InChIKey | ARDCHEMUHJMPTE-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|