C31H37F5N2O4SSi — CID 163985954
1-[3,5-difluoro-4-[3-[1-(trifluoromethyl)cyclopropyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-4-[3-(hydroxymethyl)oxetan-3-yl]butane-2-thione (PubChem CID 163985954) has the molecular formula C31H37F5N2O4SSi and a molecular weight of 656.79 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[3-[1-(trifluoromethyl)cyclopropyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-4-[3-(hydroxymethyl)oxetan-3-yl]butane-2-thione.
| Compound Name | 1-[3,5-difluoro-4-[3-[1-(trifluoromethyl)cyclopropyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-4-[3-(hydroxymethyl)oxetan-3-yl]butane-2-thione |
|---|---|
| PubChem CID | 163985954 |
| Molecular Formula | C31H37F5N2O4SSi |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | 1-[3,5-difluoro-4-[3-[1-(trifluoromethyl)cyclopropyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-4-[3-(hydroxymethyl)oxetan-3-yl]butane-2-thione |
| SMILES | C[Si](C)(C)CCOCn1cc(C2(C(F)(F)F)CC2)c2c(Oc3c(F)cc(CC(=S)CCC4(CO)COC4)cc3F)ccnc21 |
| InChI | InChI=1S/C31H37F5N2O4SSi/c1-44(2,3)11-10-40-19-38-15-22(30(7-8-30)31(34,35)36)26-25(5-9-37-28(26)38)42-27-23(32)13-20(14-24(27)33)12-21(43)4-6-29(16-39)17-41-18-29/h5,9,13-15,39H,4,6-8,10-12,16-19H2,1-3H3 |
| InChIKey | TWIXNHOPXCSQSC-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|