C31H39ClF4N2O4SSi — CID 167623857
tert-butyl 8-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4,4-difluoro-7-sulfanylideneoctanoate (PubChem CID 167623857) has the molecular formula C31H39ClF4N2O4SSi and a molecular weight of 675.26 g/mol. Its IUPAC name is tert-butyl 8-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4,4-difluoro-7-sulfanylideneoctanoate.
| Compound Name | tert-butyl 8-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4,4-difluoro-7-sulfanylideneoctanoate |
|---|---|
| PubChem CID | 167623857 |
| Molecular Formula | C31H39ClF4N2O4SSi |
| Molecular Weight | 675.26 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | tert-butyl 8-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4,4-difluoro-7-sulfanylideneoctanoate |
| SMILES | CC(C)(C)OC(=O)CCC(F)(F)CCC(=S)Cc1cc(F)c(Oc2ccnc3c2c(Cl)cn3COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C31H39ClF4N2O4SSi/c1-30(2,3)42-26(39)8-11-31(35,36)10-7-21(43)15-20-16-23(33)28(24(34)17-20)41-25-9-12-37-29-27(25)22(32)18-38(29)19-40-13-14-44(4,5)6/h9,12,16-18H,7-8,10-11,13-15,19H2,1-6H3 |
| InChIKey | MUSVQWVRZUKWIP-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.26 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|