C28H39ClF2N4O4SSi — CID 142518454
1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[2-(hydroxymethyl)-2-methyl-3-propan-2-yloxypropyl]thiourea (PubChem CID 142518454) has the molecular formula C28H39ClF2N4O4SSi and a molecular weight of 629.25 g/mol. Its IUPAC name is 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[2-(hydroxymethyl)-2-methyl-3-propan-2-yloxypropyl]thiourea.
| Compound Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[2-(hydroxymethyl)-2-methyl-3-propan-2-yloxypropyl]thiourea |
|---|---|
| PubChem CID | 142518454 |
| Molecular Formula | C28H39ClF2N4O4SSi |
| Molecular Weight | 629.25 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[2-(hydroxymethyl)-2-methyl-3-propan-2-yloxypropyl]thiourea |
| SMILES | CC(C)OCC(C)(CO)CNC(=S)Nc1cc(F)c(Oc2ccnc3c2c(Cl)cn3COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C28H39ClF2N4O4SSi/c1-18(2)38-16-28(3,15-36)14-33-27(40)34-19-11-21(30)25(22(31)12-19)39-23-7-8-32-26-24(23)20(29)13-35(26)17-37-9-10-41(4,5)6/h7-8,11-13,18,36H,9-10,14-17H2,1-6H3,(H2,33,34,40) |
| InChIKey | BSFXJHMQMJEWDM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.25 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|