C23H29ClF2N4O4SSi — CID 175772981
1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(2R)-2,3-dihydroxypropyl]thiourea (PubChem CID 175772981) has the molecular formula C23H29ClF2N4O4SSi and a molecular weight of 559.11 g/mol. Its IUPAC name is 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(2R)-2,3-dihydroxypropyl]thiourea.
| Compound Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(2R)-2,3-dihydroxypropyl]thiourea |
|---|---|
| PubChem CID | 175772981 |
| Molecular Formula | C23H29ClF2N4O4SSi |
| Molecular Weight | 559.11 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(2R)-2,3-dihydroxypropyl]thiourea |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(Oc3c(F)cc(NC(=S)NC[C@@H](O)CO)cc3F)ccnc21 |
| InChI | InChI=1S/C23H29ClF2N4O4SSi/c1-36(2,3)7-6-33-13-30-11-16(24)20-19(4-5-27-22(20)30)34-21-17(25)8-14(9-18(21)26)29-23(35)28-10-15(32)12-31/h4-5,8-9,11,15,31-32H,6-7,10,12-13H2,1-3H3,(H2,28,29,35)/t15-/m1/s1 |
| InChIKey | SYRLJAXHTONGJP-OAHLLOKOSA-N |
| XLogP | 4.71 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.11 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|