C24H29ClF2N4O3Si — CID 164933721
N-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4-methyl-5,6-dihydro-4H-1,3-oxazin-2-amine (PubChem CID 164933721) has the molecular formula C24H29ClF2N4O3Si and a molecular weight of 523.06 g/mol. Its IUPAC name is N-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4-methyl-5,6-dihydro-4H-1,3-oxazin-2-amine.
| Compound Name | N-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4-methyl-5,6-dihydro-4H-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 164933721 |
| Molecular Formula | C24H29ClF2N4O3Si |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | N-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-4-methyl-5,6-dihydro-4H-1,3-oxazin-2-amine |
| SMILES | CC1CCOC(Nc2cc(F)c(Oc3ccnc4c3c(Cl)cn4COCC[Si](C)(C)C)c(F)c2)=N1 |
| InChI | InChI=1S/C24H29ClF2N4O3Si/c1-15-6-8-33-24(29-15)30-16-11-18(26)22(19(27)12-16)34-20-5-7-28-23-21(20)17(25)13-31(23)14-32-9-10-35(2,3)4/h5,7,11-13,15H,6,8-10,14H2,1-4H3,(H,29,30) |
| InChIKey | JQGAYMUDGAZCJG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 69.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|