C20H22ClF2N3O2S2 — CID 137435283
N-[4-[3-chloro-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]methanethioamide (PubChem CID 137435283) has the molecular formula C20H22ClF2N3O2S2 and a molecular weight of 474.00 g/mol. Its IUPAC name is N-[4-[3-chloro-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]methanethioamide.
| Compound Name | N-[4-[3-chloro-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]methanethioamide |
|---|---|
| PubChem CID | 137435283 |
| Molecular Formula | C20H22ClF2N3O2S2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[4-[3-chloro-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]methanethioamide |
| SMILES | CS(C)(C)CCOCn1cc(Cl)c2c(Oc3c(F)cc(NC=S)cc3F)ccnc21 |
| InChI | InChI=1S/C20H22ClF2N3O2S2/c1-30(2,3)7-6-27-12-26-10-14(21)18-17(4-5-24-20(18)26)28-19-15(22)8-13(25-11-29)9-16(19)23/h4-5,8-11H,6-7,12H2,1-3H3,(H,25,29) |
| InChIKey | GWSUBRRDFGLYGL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|