C25H27ClF2N6O4Si — CID 162213145
1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(6-methoxypyridazin-3-yl)urea (PubChem CID 162213145) has the molecular formula C25H27ClF2N6O4Si and a molecular weight of 577.06 g/mol. Its IUPAC name is 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(6-methoxypyridazin-3-yl)urea.
| Compound Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(6-methoxypyridazin-3-yl)urea |
|---|---|
| PubChem CID | 162213145 |
| Molecular Formula | C25H27ClF2N6O4Si |
| Molecular Weight | 577.06 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(6-methoxypyridazin-3-yl)urea |
| SMILES | COc1ccc(NC(=O)Nc2cc(F)c(Oc3ccnc4c3c(Cl)cn4COCC[Si](C)(C)C)c(F)c2)nn1 |
| InChI | InChI=1S/C25H27ClF2N6O4Si/c1-36-21-6-5-20(32-33-21)31-25(35)30-15-11-17(27)23(18(28)12-15)38-19-7-8-29-24-22(19)16(26)13-34(24)14-37-9-10-39(2,3)4/h5-8,11-13H,9-10,14H2,1-4H3,(H2,30,31,32,35) |
| InChIKey | ZTCUXAOIQDOQAQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.06 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|