C30H42ClF2N5O4SSi — CID 142518312
tert-butyl N-[4-[[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]carbamothioylamino]-2-methylbutan-2-yl]carbamate (PubChem CID 142518312) has the molecular formula C30H42ClF2N5O4SSi and a molecular weight of 670.30 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]carbamothioylamino]-2-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]carbamothioylamino]-2-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142518312 |
| Molecular Formula | C30H42ClF2N5O4SSi |
| Molecular Weight | 670.30 g/mol |
| Exact Mass | 669.24 |
| IUPAC Name | tert-butyl N-[4-[[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]carbamothioylamino]-2-methylbutan-2-yl]carbamate |
| SMILES | CC(C)(CCNC(=S)Nc1cc(F)c(Oc2ccnc3c2c(Cl)cn3COCC[Si](C)(C)C)c(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H42ClF2N5O4SSi/c1-29(2,3)42-28(39)37-30(4,5)10-12-35-27(43)36-19-15-21(32)25(22(33)16-19)41-23-9-11-34-26-24(23)20(31)17-38(26)18-40-13-14-44(6,7)8/h9,11,15-17H,10,12-14,18H2,1-8H3,(H,37,39)(H2,35,36,43) |
| InChIKey | XUICUMMVZLCYCJ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.30 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|