C31H42ClF2N3O4SSi — CID 167665869
tert-butyl 5-[[2-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-1-methylsulfanylethylidene]amino]pentanoate (PubChem CID 167665869) has the molecular formula C31H42ClF2N3O4SSi and a molecular weight of 654.30 g/mol. Its IUPAC name is tert-butyl 5-[[2-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-1-methylsulfanylethylidene]amino]pentanoate.
| Compound Name | tert-butyl 5-[[2-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-1-methylsulfanylethylidene]amino]pentanoate |
|---|---|
| PubChem CID | 167665869 |
| Molecular Formula | C31H42ClF2N3O4SSi |
| Molecular Weight | 654.30 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | tert-butyl 5-[[2-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-1-methylsulfanylethylidene]amino]pentanoate |
| SMILES | CS/C(Cc1cc(F)c(Oc2ccnc3c2c(Cl)cn3COCC[Si](C)(C)C)c(F)c1)=N\CCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H42ClF2N3O4SSi/c1-31(2,3)41-27(38)10-8-9-12-35-26(42-4)18-21-16-23(33)29(24(34)17-21)40-25-11-13-36-30-28(25)22(32)19-37(30)20-39-14-15-43(5,6)7/h11,13,16-17,19H,8-10,12,14-15,18,20H2,1-7H3/b35-26- |
| InChIKey | SQBWQRTUHHYQAE-JYUHDHNASA-N |
| XLogP | 8.89 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.30 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|