C27H36ClF2N5O4Si — CID 142494704
1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 142494704) has the molecular formula C27H36ClF2N5O4Si and a molecular weight of 596.15 g/mol. Its IUPAC name is 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 142494704 |
| Molecular Formula | C27H36ClF2N5O4Si |
| Molecular Weight | 596.15 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(Oc3c(F)cc(NC(=O)NCCCN4CCOCC4)cc3F)ccnc21 |
| InChI | InChI=1S/C27H36ClF2N5O4Si/c1-40(2,3)14-13-38-18-35-17-20(28)24-23(5-7-31-26(24)35)39-25-21(29)15-19(16-22(25)30)33-27(36)32-6-4-8-34-9-11-37-12-10-34/h5,7,15-17H,4,6,8-14,18H2,1-3H3,(H2,32,33,36) |
| InChIKey | SRLWGOPUERVAEX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.15 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|